C36H39FO5Si — CID 140966529
(3R,4R,5R,6R)-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-fluoro-3,4-bis(phenylmethoxy)oxan-2-one (PubChem CID 140966529) has the molecular formula C36H39FO5Si and a molecular weight of 598.79 g/mol. Its IUPAC name is (3R,4R,5R,6R)-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-fluoro-3,4-bis(phenylmethoxy)oxan-2-one.
| Compound Name | (3R,4R,5R,6R)-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-fluoro-3,4-bis(phenylmethoxy)oxan-2-one |
|---|---|
| PubChem CID | 140966529 |
| Molecular Formula | C36H39FO5Si |
| Molecular Weight | 598.79 g/mol |
| Exact Mass | 598.26 |
| IUPAC Name | (3R,4R,5R,6R)-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-fluoro-3,4-bis(phenylmethoxy)oxan-2-one |
| SMILES | CC(C)(C)[Si](OC[C@H]1OC(=O)[C@H](OCc2ccccc2)[C@@H](OCc2ccccc2)[C@@H]1F)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C36H39FO5Si/c1-36(2,3)43(29-20-12-6-13-21-29,30-22-14-7-15-23-30)41-26-31-32(37)33(39-24-27-16-8-4-9-17-27)34(35(38)42-31)40-25-28-18-10-5-11-19-28/h4-23,31-34H,24-26H2,1-3H3/t31-,32-,33+,34-/m1/s1 |
| InChIKey | HJWJDRMCVHNECK-YVEASBDZSA-N |
| XLogP | 6.00 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.79 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|