C31H39NO4Si — CID 11249365
(3S,4S,5S)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-(phenylmethoxyamino)-3-propyloxolan-2-one (PubChem CID 11249365) has the molecular formula C31H39NO4Si and a molecular weight of 517.74 g/mol. Its IUPAC name is (3S,4S,5S)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-(phenylmethoxyamino)-3-propyloxolan-2-one.
| Compound Name | (3S,4S,5S)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-(phenylmethoxyamino)-3-propyloxolan-2-one |
|---|---|
| PubChem CID | 11249365 |
| Molecular Formula | C31H39NO4Si |
| Molecular Weight | 517.74 g/mol |
| Exact Mass | 517.26 |
| IUPAC Name | (3S,4S,5S)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-(phenylmethoxyamino)-3-propyloxolan-2-one |
| SMILES | CCC[C@@H]1C(=O)O[C@H](CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)[C@H]1NOCc1ccccc1 |
| InChI | InChI=1S/C31H39NO4Si/c1-5-15-27-29(32-34-22-24-16-9-6-10-17-24)28(36-30(27)33)23-35-37(31(2,3)4,25-18-11-7-12-19-25)26-20-13-8-14-21-26/h6-14,16-21,27-29,32H,5,15,22-23H2,1-4H3/t27-,28+,29-/m0/s1 |
| InChIKey | BOHOQJCRFZKLDH-NHKHRBQYSA-N |
| XLogP | 4.99 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.74 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|