C29H32O5Si — CID 102034930
(2S,3S)-4-[tert-butyl(diphenyl)silyl]oxy-2-(hydroxymethyl)-3-phenylmethoxy-2,3-dihydropyran-6-one (PubChem CID 102034930) has the molecular formula C29H32O5Si and a molecular weight of 488.66 g/mol. Its IUPAC name is (2S,3S)-4-[tert-butyl(diphenyl)silyl]oxy-2-(hydroxymethyl)-3-phenylmethoxy-2,3-dihydropyran-6-one.
| Compound Name | (2S,3S)-4-[tert-butyl(diphenyl)silyl]oxy-2-(hydroxymethyl)-3-phenylmethoxy-2,3-dihydropyran-6-one |
|---|---|
| PubChem CID | 102034930 |
| Molecular Formula | C29H32O5Si |
| Molecular Weight | 488.66 g/mol |
| Exact Mass | 488.20 |
| IUPAC Name | (2S,3S)-4-[tert-butyl(diphenyl)silyl]oxy-2-(hydroxymethyl)-3-phenylmethoxy-2,3-dihydropyran-6-one |
| SMILES | CC(C)(C)[Si](OC1=CC(=O)O[C@@H](CO)[C@@H]1OCc1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C29H32O5Si/c1-29(2,3)35(23-15-9-5-10-16-23,24-17-11-6-12-18-24)34-25-19-27(31)33-26(20-30)28(25)32-21-22-13-7-4-8-14-22/h4-19,26,28,30H,20-21H2,1-3H3/t26-,28+/m0/s1 |
| InChIKey | LREMCWWMQZAWAX-XTEPFMGCSA-N |
| XLogP | 3.95 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.66 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|