C25H32O4Si — CID 24797076
(2R,3S,5Z)-3-[tert-butyl(diphenyl)silyl]oxy-2-(hydroxymethyl)-3,4,7,8-tetrahydro-2H-oxonin-9-one (PubChem CID 24797076) has the molecular formula C25H32O4Si and a molecular weight of 424.61 g/mol. Its IUPAC name is (2R,3S,5Z)-3-[tert-butyl(diphenyl)silyl]oxy-2-(hydroxymethyl)-3,4,7,8-tetrahydro-2H-oxonin-9-one.
| Compound Name | (2R,3S,5Z)-3-[tert-butyl(diphenyl)silyl]oxy-2-(hydroxymethyl)-3,4,7,8-tetrahydro-2H-oxonin-9-one |
|---|---|
| PubChem CID | 24797076 |
| Molecular Formula | C25H32O4Si |
| Molecular Weight | 424.61 g/mol |
| Exact Mass | 424.21 |
| IUPAC Name | (2R,3S,5Z)-3-[tert-butyl(diphenyl)silyl]oxy-2-(hydroxymethyl)-3,4,7,8-tetrahydro-2H-oxonin-9-one |
| SMILES | CC(C)(C)[Si](O[C@H]1C/C=C\CCC(=O)O[C@@H]1CO)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C25H32O4Si/c1-25(2,3)30(20-13-7-4-8-14-20,21-15-9-5-10-16-21)29-22-17-11-6-12-18-24(27)28-23(22)19-26/h4-11,13-16,22-23,26H,12,17-19H2,1-3H3/b11-6-/t22-,23+/m0/s1 |
| InChIKey | CEZYTAZFYFRFCU-GONLBCNTSA-N |
| XLogP | 3.58 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.61 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|