C24H34O3Si — CID 101389307
2-[(2R,3S,6R)-3-[tert-butyl(diphenyl)silyl]oxy-6-methyloxan-2-yl]ethanol (PubChem CID 101389307) has the molecular formula C24H34O3Si and a molecular weight of 398.62 g/mol. Its IUPAC name is 2-[(2R,3S,6R)-3-[tert-butyl(diphenyl)silyl]oxy-6-methyloxan-2-yl]ethanol.
| Compound Name | 2-[(2R,3S,6R)-3-[tert-butyl(diphenyl)silyl]oxy-6-methyloxan-2-yl]ethanol |
|---|---|
| PubChem CID | 101389307 |
| Molecular Formula | C24H34O3Si |
| Molecular Weight | 398.62 g/mol |
| Exact Mass | 398.23 |
| IUPAC Name | 2-[(2R,3S,6R)-3-[tert-butyl(diphenyl)silyl]oxy-6-methyloxan-2-yl]ethanol |
| SMILES | C[C@@H]1CC[C@H](O[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)[C@@H](CCO)O1 |
| InChI | InChI=1S/C24H34O3Si/c1-19-15-16-23(22(26-19)17-18-25)27-28(24(2,3)4,20-11-7-5-8-12-20)21-13-9-6-10-14-21/h5-14,19,22-23,25H,15-18H2,1-4H3/t19-,22-,23+/m1/s1 |
| InChIKey | ICZXSDHKXJNYLF-PTUXOGIPSA-N |
| XLogP | 3.88 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.62 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|