C22H28O2Si — CID 11462313
tert-butyl-[[(1R,2R,6R)-7-oxabicyclo[4.1.0]heptan-2-yl]oxy]-diphenylsilane (PubChem CID 11462313) has the molecular formula C22H28O2Si and a molecular weight of 352.55 g/mol. Its IUPAC name is tert-butyl-[[(1R,2R,6R)-7-oxabicyclo[4.1.0]heptan-2-yl]oxy]-diphenylsilane.
| Compound Name | tert-butyl-[[(1R,2R,6R)-7-oxabicyclo[4.1.0]heptan-2-yl]oxy]-diphenylsilane |
|---|---|
| PubChem CID | 11462313 |
| Molecular Formula | C22H28O2Si |
| Molecular Weight | 352.55 g/mol |
| Exact Mass | 352.19 |
| IUPAC Name | tert-butyl-[[(1R,2R,6R)-7-oxabicyclo[4.1.0]heptan-2-yl]oxy]-diphenylsilane |
| SMILES | CC(C)(C)[Si](O[C@@H]1CCC[C@H]2O[C@H]21)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C22H28O2Si/c1-22(2,3)25(17-11-6-4-7-12-17,18-13-8-5-9-14-18)24-20-16-10-15-19-21(20)23-19/h4-9,11-14,19-21H,10,15-16H2,1-3H3/t19-,20-,21-/m1/s1 |
| InChIKey | BPCDUWUWNOSJAW-NJDAHSKKSA-N |
| XLogP | 3.88 |
| TPSA | 21.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.55 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|