C26H32N2OSi — CID 71485535
tert-butyl-diphenyl-[(2R,3S)-2-pyridin-3-ylpiperidin-3-yl]oxysilane (PubChem CID 71485535) has the molecular formula C26H32N2OSi and a molecular weight of 416.64 g/mol. Its IUPAC name is tert-butyl-diphenyl-[(2R,3S)-2-pyridin-3-ylpiperidin-3-yl]oxysilane.
| Compound Name | tert-butyl-diphenyl-[(2R,3S)-2-pyridin-3-ylpiperidin-3-yl]oxysilane |
|---|---|
| PubChem CID | 71485535 |
| Molecular Formula | C26H32N2OSi |
| Molecular Weight | 416.64 g/mol |
| Exact Mass | 416.23 |
| IUPAC Name | tert-butyl-diphenyl-[(2R,3S)-2-pyridin-3-ylpiperidin-3-yl]oxysilane |
| SMILES | CC(C)(C)[Si](O[C@H]1CCCN[C@@H]1c1cccnc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C26H32N2OSi/c1-26(2,3)30(22-13-6-4-7-14-22,23-15-8-5-9-16-23)29-24-17-11-19-28-25(24)21-12-10-18-27-20-21/h4-10,12-16,18,20,24-25,28H,11,17,19H2,1-3H3/t24-,25+/m0/s1 |
| InChIKey | MBAFWYXYILHJSO-LOSJGSFVSA-N |
| XLogP | 4.45 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.64 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|