C23H30O2Si — CID 58018792
cis-(1R,2R)-2-[tert-butyl(diphenyl)silyl]oxycyclohexane-1-carbaldehyde (PubChem CID 58018792) has the molecular formula C23H30O2Si and a molecular weight of 366.58 g/mol. Its IUPAC name is cis-(1R,2R)-2-[tert-butyl(diphenyl)silyl]oxycyclohexane-1-carbaldehyde.
| Compound Name | cis-(1R,2R)-2-[tert-butyl(diphenyl)silyl]oxycyclohexane-1-carbaldehyde |
|---|---|
| PubChem CID | 58018792 |
| Molecular Formula | C23H30O2Si |
| Molecular Weight | 366.58 g/mol |
| Exact Mass | 366.20 |
| IUPAC Name | cis-(1R,2R)-2-[tert-butyl(diphenyl)silyl]oxycyclohexane-1-carbaldehyde |
| SMILES | CC(C)(C)[Si](O[C@@H]1CCCC[C@H]1C=O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C23H30O2Si/c1-23(2,3)26(20-13-6-4-7-14-20,21-15-8-5-9-16-21)25-22-17-11-10-12-19(22)18-24/h4-9,13-16,18-19,22H,10-12,17H2,1-3H3/t19-,22+/m0/s1 |
| InChIKey | LLRLBBRCRQRUDX-SIKLNZKXSA-N |
| XLogP | 4.32 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.58 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|