C26H34O2Si — CID 11373147
(3aR,4R,7aS)-4-[tert-butyl(diphenyl)silyl]oxy-7a-methyl-3,3a,4,5,6,7-hexahydro-2H-inden-1-one (PubChem CID 11373147) has the molecular formula C26H34O2Si and a molecular weight of 406.64 g/mol. Its IUPAC name is (3aR,4R,7aS)-4-[tert-butyl(diphenyl)silyl]oxy-7a-methyl-3,3a,4,5,6,7-hexahydro-2H-inden-1-one.
| Compound Name | (3aR,4R,7aS)-4-[tert-butyl(diphenyl)silyl]oxy-7a-methyl-3,3a,4,5,6,7-hexahydro-2H-inden-1-one |
|---|---|
| PubChem CID | 11373147 |
| Molecular Formula | C26H34O2Si |
| Molecular Weight | 406.64 g/mol |
| Exact Mass | 406.23 |
| IUPAC Name | (3aR,4R,7aS)-4-[tert-butyl(diphenyl)silyl]oxy-7a-methyl-3,3a,4,5,6,7-hexahydro-2H-inden-1-one |
| SMILES | CC(C)(C)[Si](O[C@@H]1CCC[C@]2(C)C(=O)CC[C@@H]12)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C26H34O2Si/c1-25(2,3)29(20-12-7-5-8-13-20,21-14-9-6-10-15-21)28-23-16-11-19-26(4)22(23)17-18-24(26)27/h5-10,12-15,22-23H,11,16-19H2,1-4H3/t22-,23+,26-/m0/s1 |
| InChIKey | VEKUQILTWWGIEU-ZEVJAHDQSA-N |
| XLogP | 5.10 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.64 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|