C35H46O2Si — CID 68725089
(8R,9S,10R,13S,14S)-3-[tert-butyl(diphenyl)silyl]oxy-10,13-dimethyl-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-17-one (PubChem CID 68725089) has the molecular formula C35H46O2Si and a molecular weight of 526.84 g/mol. Its IUPAC name is (8R,9S,10R,13S,14S)-3-[tert-butyl(diphenyl)silyl]oxy-10,13-dimethyl-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-17-one.
| Compound Name | (8R,9S,10R,13S,14S)-3-[tert-butyl(diphenyl)silyl]oxy-10,13-dimethyl-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-17-one |
|---|---|
| PubChem CID | 68725089 |
| Molecular Formula | C35H46O2Si |
| Molecular Weight | 526.84 g/mol |
| Exact Mass | 526.33 |
| IUPAC Name | (8R,9S,10R,13S,14S)-3-[tert-butyl(diphenyl)silyl]oxy-10,13-dimethyl-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-17-one |
| SMILES | CC(C)(C)[Si](OC1CC[C@@]2(C)C(=CC[C@@H]3[C@@H]2CC[C@]2(C)C(=O)CC[C@@H]32)C1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C35H46O2Si/c1-33(2,3)38(27-12-8-6-9-13-27,28-14-10-7-11-15-28)37-26-20-22-34(4)25(24-26)16-17-29-30-18-19-32(36)35(30,5)23-21-31(29)34/h6-16,26,29-31H,17-24H2,1-5H3/t26?,29-,30-,31-,34-,35-/m0/s1 |
| InChIKey | DDUQHZIMNFAOCD-KYJAHWKJSA-N |
| XLogP | 7.46 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.84 |
| LogP ≤ 5 | 7.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|