C35H44O3Si — CID 10209115
(3S,10R,13S)-3-[tert-butyl(diphenyl)silyl]oxy-10,13-dimethyl-2,3,4,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthrene-7,17-dione (PubChem CID 10209115) has the molecular formula C35H44O3Si and a molecular weight of 540.82 g/mol. Its IUPAC name is (3S,10R,13S)-3-[tert-butyl(diphenyl)silyl]oxy-10,13-dimethyl-2,3,4,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthrene-7,17-dione.
| Compound Name | (3S,10R,13S)-3-[tert-butyl(diphenyl)silyl]oxy-10,13-dimethyl-2,3,4,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthrene-7,17-dione |
|---|---|
| PubChem CID | 10209115 |
| Molecular Formula | C35H44O3Si |
| Molecular Weight | 540.82 g/mol |
| Exact Mass | 540.31 |
| IUPAC Name | (3S,10R,13S)-3-[tert-butyl(diphenyl)silyl]oxy-10,13-dimethyl-2,3,4,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthrene-7,17-dione |
| SMILES | CC(C)(C)[Si](O[C@H]1CC[C@@]2(C)C(=CC(=O)C3C2CC[C@]2(C)C(=O)CCC32)C1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C35H44O3Si/c1-33(2,3)39(26-12-8-6-9-13-26,27-14-10-7-11-15-27)38-25-18-20-34(4)24(22-25)23-30(36)32-28-16-17-31(37)35(28,5)21-19-29(32)34/h6-15,23,25,28-29,32H,16-22H2,1-5H3/t25-,28?,29?,32?,34-,35-/m0/s1 |
| InChIKey | PDSNWZLLSOCRQI-RCEHNNGJSA-N |
| XLogP | 6.64 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.82 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|