C28H42O5 — CID 101106147
[(3S,8R,9S,10R,13S,14S)-10,13-dimethyl-7,17-dioxo-2,3,4,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-3-yl] octyl carbonate (PubChem CID 101106147) has the molecular formula C28H42O5 and a molecular weight of 458.64 g/mol. Its IUPAC name is [(3S,8R,9S,10R,13S,14S)-10,13-dimethyl-7,17-dioxo-2,3,4,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-3-yl] octyl carbonate.
| Compound Name | [(3S,8R,9S,10R,13S,14S)-10,13-dimethyl-7,17-dioxo-2,3,4,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-3-yl] octyl carbonate |
|---|---|
| PubChem CID | 101106147 |
| Molecular Formula | C28H42O5 |
| Molecular Weight | 458.64 g/mol |
| Exact Mass | 458.30 |
| IUPAC Name | [(3S,8R,9S,10R,13S,14S)-10,13-dimethyl-7,17-dioxo-2,3,4,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-3-yl] octyl carbonate |
| SMILES | CCCCCCCCOC(=O)O[C@H]1CC[C@@]2(C)C(=CC(=O)[C@@H]3[C@@H]2CC[C@]2(C)C(=O)CC[C@@H]32)C1 |
| InChI | InChI=1S/C28H42O5/c1-4-5-6-7-8-9-16-32-26(31)33-20-12-14-27(2)19(17-20)18-23(29)25-21-10-11-24(30)28(21,3)15-13-22(25)27/h18,20-22,25H,4-17H2,1-3H3/t20-,21-,22-,25-,27-,28-/m0/s1 |
| InChIKey | BTCNMXMUPSJISJ-XJJFSGBMSA-N |
| XLogP | 6.58 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.64 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|