C28H40O4 — CID 10114181
[(3S,10R,13S)-10,13-dimethyl-7,17-dioxo-2,3,4,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-3-yl] 4-cyclopentylbutanoate (PubChem CID 10114181) has the molecular formula C28H40O4 and a molecular weight of 440.62 g/mol. Its IUPAC name is [(3S,10R,13S)-10,13-dimethyl-7,17-dioxo-2,3,4,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-3-yl] 4-cyclopentylbutanoate.
| Compound Name | [(3S,10R,13S)-10,13-dimethyl-7,17-dioxo-2,3,4,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-3-yl] 4-cyclopentylbutanoate |
|---|---|
| PubChem CID | 10114181 |
| Molecular Formula | C28H40O4 |
| Molecular Weight | 440.62 g/mol |
| Exact Mass | 440.29 |
| IUPAC Name | [(3S,10R,13S)-10,13-dimethyl-7,17-dioxo-2,3,4,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-3-yl] 4-cyclopentylbutanoate |
| SMILES | C[C@]12CC[C@H](OC(=O)CCCC3CCCC3)CC1=CC(=O)C1C2CC[C@]2(C)C(=O)CCC12 |
| InChI | InChI=1S/C28H40O4/c1-27-14-12-20(32-25(31)9-5-8-18-6-3-4-7-18)16-19(27)17-23(29)26-21-10-11-24(30)28(21,2)15-13-22(26)27/h17-18,20-22,26H,3-16H2,1-2H3/t20-,21?,22?,26?,27-,28-/m0/s1 |
| InChIKey | ABUYGHNUCVLAHJ-GSYORLGFSA-N |
| XLogP | 5.97 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.62 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |