C25H43NO2Si — CID 102254868
(4aS,4bR,8S,10aR,10bS,12aS)-8-[tert-butyl(dimethyl)silyl]oxy-10a,12a-dimethyl-3,4,4a,4b,5,7,8,9,10,10b,11,12-dodecahydro-1H-naphtho[2,1-f]quinolin-2-one (PubChem CID 102254868) has the molecular formula C25H43NO2Si and a molecular weight of 417.71 g/mol. Its IUPAC name is (4aS,4bR,8S,10aR,10bS,12aS)-8-[tert-butyl(dimethyl)silyl]oxy-10a,12a-dimethyl-3,4,4a,4b,5,7,8,9,10,10b,11,12-dodecahydro-1H-naphtho[2,1-f]quinolin-2-one.
| Compound Name | (4aS,4bR,8S,10aR,10bS,12aS)-8-[tert-butyl(dimethyl)silyl]oxy-10a,12a-dimethyl-3,4,4a,4b,5,7,8,9,10,10b,11,12-dodecahydro-1H-naphtho[2,1-f]quinolin-2-one |
|---|---|
| PubChem CID | 102254868 |
| Molecular Formula | C25H43NO2Si |
| Molecular Weight | 417.71 g/mol |
| Exact Mass | 417.31 |
| IUPAC Name | (4aS,4bR,8S,10aR,10bS,12aS)-8-[tert-butyl(dimethyl)silyl]oxy-10a,12a-dimethyl-3,4,4a,4b,5,7,8,9,10,10b,11,12-dodecahydro-1H-naphtho[2,1-f]quinolin-2-one |
| SMILES | CC(C)(C)[Si](C)(C)O[C@H]1CC[C@@]2(C)C(=CC[C@@H]3[C@@H]2CC[C@]2(C)NC(=O)CC[C@@H]32)C1 |
| InChI | InChI=1S/C25H43NO2Si/c1-23(2,3)29(6,7)28-18-12-14-24(4)17(16-18)8-9-19-20(24)13-15-25(5)21(19)10-11-22(27)26-25/h8,18-21H,9-16H2,1-7H3,(H,26,27)/t18-,19+,20-,21-,24-,25-/m0/s1 |
| InChIKey | OUWVXLIDEVCRND-QFNYRDOESA-N |
| XLogP | 6.21 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.71 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|