C32H56O2Si2 — CID 22799610
tert-butyl-[[(3S,8R,9S,14S,17S)-3-[tert-butyl(dimethyl)silyl]oxy-13-ethynyl-10-methyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]oxy]-dimethylsilane (PubChem CID 22799610) has the molecular formula C32H56O2Si2 and a molecular weight of 528.97 g/mol. Its IUPAC name is tert-butyl-[[(3S,8R,9S,14S,17S)-3-[tert-butyl(dimethyl)silyl]oxy-13-ethynyl-10-methyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]oxy]-dimethylsilane.
| Compound Name | tert-butyl-[[(3S,8R,9S,14S,17S)-3-[tert-butyl(dimethyl)silyl]oxy-13-ethynyl-10-methyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]oxy]-dimethylsilane |
|---|---|
| PubChem CID | 22799610 |
| Molecular Formula | C32H56O2Si2 |
| Molecular Weight | 528.97 g/mol |
| Exact Mass | 528.38 |
| IUPAC Name | tert-butyl-[[(3S,8R,9S,14S,17S)-3-[tert-butyl(dimethyl)silyl]oxy-13-ethynyl-10-methyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]oxy]-dimethylsilane |
| SMILES | C#CC12CC[C@H]3[C@@H](CC=C4C[C@@H](O[Si](C)(C)C(C)(C)C)CCC43C)[C@@H]1CC[C@@H]2O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C32H56O2Si2/c1-13-32-21-19-26-25(27(32)16-17-28(32)34-36(11,12)30(5,6)7)15-14-23-22-24(18-20-31(23,26)8)33-35(9,10)29(2,3)4/h1,14,24-28H,15-22H2,2-12H3/t24-,25+,26-,27-,28-,31?,32?/m0/s1 |
| InChIKey | PASNXIBCNCURFQ-PUUXBZOPSA-N |
| XLogP | 9.34 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.97 |
| LogP ≤ 5 | 9.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|