C29H49NO2Si — CID 102387375
4-[(8S,9S,10R,13S,14S)-3-[tert-butyl(dimethyl)silyl]oxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]pyrrolidin-2-one (PubChem CID 102387375) has the molecular formula C29H49NO2Si and a molecular weight of 471.80 g/mol. Its IUPAC name is 4-[(8S,9S,10R,13S,14S)-3-[tert-butyl(dimethyl)silyl]oxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]pyrrolidin-2-one.
| Compound Name | 4-[(8S,9S,10R,13S,14S)-3-[tert-butyl(dimethyl)silyl]oxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 102387375 |
| Molecular Formula | C29H49NO2Si |
| Molecular Weight | 471.80 g/mol |
| Exact Mass | 471.35 |
| IUPAC Name | 4-[(8S,9S,10R,13S,14S)-3-[tert-butyl(dimethyl)silyl]oxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]pyrrolidin-2-one |
| SMILES | CC(C)(C)[Si](C)(C)OC1CC[C@@]2(C)C(=CC[C@@H]3[C@@H]2CC[C@]2(C)C(C4CNC(=O)C4)CC[C@@H]32)C1 |
| InChI | InChI=1S/C29H49NO2Si/c1-27(2,3)33(6,7)32-21-12-14-28(4)20(17-21)8-9-22-24-11-10-23(19-16-26(31)30-18-19)29(24,5)15-13-25(22)28/h8,19,21-25H,9-18H2,1-7H3,(H,30,31)/t19?,21?,22-,23?,24-,25-,28-,29+/m0/s1 |
| InChIKey | WMSNRWFQJQWWDN-XNLQSIJMSA-N |
| XLogP | 7.09 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.80 |
| LogP ≤ 5 | 7.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|