C29H50OSi — CID 89249828
[(3S,8S,9S,10R,13R,14S,17R)-17-[(2S)-but-3-en-2-yl]-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]oxy-tert-butyl-dimethylsilane (PubChem CID 89249828) has the molecular formula C29H50OSi and a molecular weight of 442.80 g/mol. Its IUPAC name is [(3S,8S,9S,10R,13R,14S,17R)-17-[(2S)-but-3-en-2-yl]-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]oxy-tert-butyl-dimethylsilane.
| Compound Name | [(3S,8S,9S,10R,13R,14S,17R)-17-[(2S)-but-3-en-2-yl]-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]oxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 89249828 |
| Molecular Formula | C29H50OSi |
| Molecular Weight | 442.80 g/mol |
| Exact Mass | 442.36 |
| IUPAC Name | [(3S,8S,9S,10R,13R,14S,17R)-17-[(2S)-but-3-en-2-yl]-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]oxy-tert-butyl-dimethylsilane |
| SMILES | C=C[C@H](C)[C@H]1CC[C@H]2[C@@H]3CC=C4C[C@@H](O[Si](C)(C)C(C)(C)C)CC[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C29H50OSi/c1-10-20(2)24-13-14-25-23-12-11-21-19-22(30-31(8,9)27(3,4)5)15-17-28(21,6)26(23)16-18-29(24,25)7/h10-11,20,22-26H,1,12-19H2,2-9H3/t20-,22-,23-,24+,25-,26-,28-,29+/m0/s1 |
| InChIKey | QVFGGLFUTUATBQ-MSZUPSMGSA-N |
| XLogP | 8.78 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.80 |
| LogP ≤ 5 | 8.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|