C34H64O2Si2 — CID 582127
[6-(10,13-dimethyl-3-trimethylsilyloxy-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl)-2,3-dimethylheptan-2-yl]oxy-trimethylsilane (PubChem CID 582127) has the molecular formula C34H64O2Si2 and a molecular weight of 561.06 g/mol. Its IUPAC name is [6-(10,13-dimethyl-3-trimethylsilyloxy-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl)-2,3-dimethylheptan-2-yl]oxy-trimethylsilane.
| Compound Name | [6-(10,13-dimethyl-3-trimethylsilyloxy-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl)-2,3-dimethylheptan-2-yl]oxy-trimethylsilane |
|---|---|
| PubChem CID | 582127 |
| Molecular Formula | C34H64O2Si2 |
| Molecular Weight | 561.06 g/mol |
| Exact Mass | 560.44 |
| IUPAC Name | [6-(10,13-dimethyl-3-trimethylsilyloxy-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl)-2,3-dimethylheptan-2-yl]oxy-trimethylsilane |
| SMILES | CC(CCC(C)C(C)(C)O[Si](C)(C)C)C1CCC2C3CC=C4CC(O[Si](C)(C)C)CCC4(C)C3CCC12C |
| InChI | InChI=1S/C34H64O2Si2/c1-24(13-14-25(2)32(3,4)36-38(10,11)12)29-17-18-30-28-16-15-26-23-27(35-37(7,8)9)19-21-33(26,5)31(28)20-22-34(29,30)6/h15,24-25,27-31H,13-14,16-23H2,1-12H3 |
| InChIKey | BGKAEWXFXHEFSY-UHFFFAOYSA-N |
| XLogP | 10.47 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.06 |
| LogP ≤ 5 | 10.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|