C33H62O2Si2 — CID 6428012
[(3S,10R,13R,17R)-10,13-dimethyl-17-[(2R)-6-methyl-7-trimethylsilyloxyheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]oxy-trimethylsilane (PubChem CID 6428012) has the molecular formula C33H62O2Si2 and a molecular weight of 547.03 g/mol. Its IUPAC name is [(3S,10R,13R,17R)-10,13-dimethyl-17-[(2R)-6-methyl-7-trimethylsilyloxyheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]oxy-trimethylsilane.
| Compound Name | [(3S,10R,13R,17R)-10,13-dimethyl-17-[(2R)-6-methyl-7-trimethylsilyloxyheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]oxy-trimethylsilane |
|---|---|
| PubChem CID | 6428012 |
| Molecular Formula | C33H62O2Si2 |
| Molecular Weight | 547.03 g/mol |
| Exact Mass | 546.43 |
| IUPAC Name | [(3S,10R,13R,17R)-10,13-dimethyl-17-[(2R)-6-methyl-7-trimethylsilyloxyheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]oxy-trimethylsilane |
| SMILES | CC(CCC[C@@H](C)[C@H]1CCC2C3CC=C4C[C@@H](O[Si](C)(C)C)CC[C@]4(C)C3CC[C@@]21C)CO[Si](C)(C)C |
| InChI | InChI=1S/C33H62O2Si2/c1-24(23-34-36(5,6)7)12-11-13-25(2)29-16-17-30-28-15-14-26-22-27(35-37(8,9)10)18-20-32(26,3)31(28)19-21-33(29,30)4/h14,24-25,27-31H,11-13,15-23H2,1-10H3/t24?,25-,27+,28?,29-,30?,31?,32+,33-/m1/s1 |
| InChIKey | XPOWNWJGSYYWLA-YANUZGJUSA-N |
| XLogP | 10.08 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.03 |
| LogP ≤ 5 | 10.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|