C30H58O3Si3 — CID 91749403
[(10R,13S,17S)-17-[1,2-bis(trimethylsilyloxy)ethyl]-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]oxy-trimethylsilane (PubChem CID 91749403) has the molecular formula C30H58O3Si3 and a molecular weight of 551.05 g/mol. Its IUPAC name is [(10R,13S,17S)-17-[1,2-bis(trimethylsilyloxy)ethyl]-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]oxy-trimethylsilane.
| Compound Name | [(10R,13S,17S)-17-[1,2-bis(trimethylsilyloxy)ethyl]-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]oxy-trimethylsilane |
|---|---|
| PubChem CID | 91749403 |
| Molecular Formula | C30H58O3Si3 |
| Molecular Weight | 551.05 g/mol |
| Exact Mass | 550.37 |
| IUPAC Name | [(10R,13S,17S)-17-[1,2-bis(trimethylsilyloxy)ethyl]-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]oxy-trimethylsilane |
| SMILES | C[C@]12CCC(O[Si](C)(C)C)CC1=CCC1C2CC[C@@]2(C)C1CC[C@@H]2C(CO[Si](C)(C)C)O[Si](C)(C)C |
| InChI | InChI=1S/C30H58O3Si3/c1-29-18-16-23(32-35(6,7)8)20-22(29)12-13-24-25-14-15-27(30(25,2)19-17-26(24)29)28(33-36(9,10)11)21-31-34(3,4)5/h12,23-28H,13-21H2,1-11H3/t23?,24?,25?,26?,27-,28?,29+,30+/m1/s1 |
| InChIKey | RBSXFFWTNZTHKA-SGYZYQPMSA-N |
| XLogP | 8.86 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.05 |
| LogP ≤ 5 | 8.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|