C27H50O2Si2 — CID 91696580
2-[(3S,8S,9S,10R,13R,14S,17R)-10,13-dimethyl-3-trimethylsilyloxy-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]ethoxy-trimethylsilane (PubChem CID 91696580) has the molecular formula C27H50O2Si2 and a molecular weight of 462.87 g/mol. Its IUPAC name is 2-[(3S,8S,9S,10R,13R,14S,17R)-10,13-dimethyl-3-trimethylsilyloxy-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]ethoxy-trimethylsilane.
| Compound Name | 2-[(3S,8S,9S,10R,13R,14S,17R)-10,13-dimethyl-3-trimethylsilyloxy-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]ethoxy-trimethylsilane |
|---|---|
| PubChem CID | 91696580 |
| Molecular Formula | C27H50O2Si2 |
| Molecular Weight | 462.87 g/mol |
| Exact Mass | 462.33 |
| IUPAC Name | 2-[(3S,8S,9S,10R,13R,14S,17R)-10,13-dimethyl-3-trimethylsilyloxy-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]ethoxy-trimethylsilane |
| SMILES | C[C@]12CC[C@H]3[C@@H](CC=C4C[C@@H](O[Si](C)(C)C)CC[C@@]43C)[C@@H]1CC[C@@H]2CCO[Si](C)(C)C |
| InChI | InChI=1S/C27H50O2Si2/c1-26-17-14-25-23(24(26)12-10-20(26)15-18-28-30(3,4)5)11-9-21-19-22(29-31(6,7)8)13-16-27(21,25)2/h9,20,22-25H,10-19H2,1-8H3/t20-,22+,23+,24+,25+,26-,27+/m1/s1 |
| InChIKey | DOTXUNYWKRWVMO-LZYXPVFYSA-N |
| XLogP | 8.03 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.87 |
| LogP ≤ 5 | 8.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|