C28H48O2Si — CID 11113063
(Z)-3-[(8S,9S,10R,13R,14S,17R)-3-[tert-butyl(dimethyl)silyl]oxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]prop-2-en-1-ol (PubChem CID 11113063) has the molecular formula C28H48O2Si and a molecular weight of 444.78 g/mol. Its IUPAC name is (Z)-3-[(8S,9S,10R,13R,14S,17R)-3-[tert-butyl(dimethyl)silyl]oxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]prop-2-en-1-ol.
| Compound Name | (Z)-3-[(8S,9S,10R,13R,14S,17R)-3-[tert-butyl(dimethyl)silyl]oxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]prop-2-en-1-ol |
|---|---|
| PubChem CID | 11113063 |
| Molecular Formula | C28H48O2Si |
| Molecular Weight | 444.78 g/mol |
| Exact Mass | 444.34 |
| IUPAC Name | (Z)-3-[(8S,9S,10R,13R,14S,17R)-3-[tert-butyl(dimethyl)silyl]oxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]prop-2-en-1-ol |
| SMILES | CC(C)(C)[Si](C)(C)OC1CC[C@@]2(C)C(=CC[C@H]3[C@@H]4CC[C@H](/C=C\CO)[C@@]4(C)CC[C@@H]32)C1 |
| InChI | InChI=1S/C28H48O2Si/c1-26(2,3)31(6,7)30-22-14-16-28(5)21(19-22)10-12-23-24-13-11-20(9-8-18-29)27(24,4)17-15-25(23)28/h8-10,20,22-25,29H,11-19H2,1-7H3/b9-8-/t20-,22?,23-,24-,25-,27+,28-/m0/s1 |
| InChIKey | GEVGZJYRYIQLFT-ONNPCIJXSA-N |
| XLogP | 7.50 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.78 |
| LogP ≤ 5 | 7.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|