C27H46O2Si — CID 14882760
tert-butyl-[[(3S,8R,9S,10R,13S,14S,17S)-17-ethenoxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]oxy]-dimethylsilane (PubChem CID 14882760) has the molecular formula C27H46O2Si and a molecular weight of 430.75 g/mol. Its IUPAC name is tert-butyl-[[(3S,8R,9S,10R,13S,14S,17S)-17-ethenoxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]oxy]-dimethylsilane.
| Compound Name | tert-butyl-[[(3S,8R,9S,10R,13S,14S,17S)-17-ethenoxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]oxy]-dimethylsilane |
|---|---|
| PubChem CID | 14882760 |
| Molecular Formula | C27H46O2Si |
| Molecular Weight | 430.75 g/mol |
| Exact Mass | 430.33 |
| IUPAC Name | tert-butyl-[[(3S,8R,9S,10R,13S,14S,17S)-17-ethenoxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]oxy]-dimethylsilane |
| SMILES | C=CO[C@H]1CC[C@H]2[C@@H]3CC=C4C[C@@H](O[Si](C)(C)C(C)(C)C)CC[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C27H46O2Si/c1-9-28-24-13-12-22-21-11-10-19-18-20(29-30(7,8)25(2,3)4)14-16-26(19,5)23(21)15-17-27(22,24)6/h9-10,20-24H,1,11-18H2,2-8H3/t20-,21-,22-,23-,24-,26-,27-/m0/s1 |
| InChIKey | VMMFSIAMHSBNKY-RNIUOSIHSA-N |
| XLogP | 7.87 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.75 |
| LogP ≤ 5 | 7.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|