C29H48O2Si — CID 89081978
(3S,10R,13S,17R)-17-[(2R)-but-3-en-2-yl]-3-[tert-butyl(dimethyl)silyl]oxy-10,13-dimethyl-1,2,3,4,7,8,9,11,12,14,15,17-dodecahydrocyclopenta[a]phenanthren-16-one (PubChem CID 89081978) has the molecular formula C29H48O2Si and a molecular weight of 456.79 g/mol. Its IUPAC name is (3S,10R,13S,17R)-17-[(2R)-but-3-en-2-yl]-3-[tert-butyl(dimethyl)silyl]oxy-10,13-dimethyl-1,2,3,4,7,8,9,11,12,14,15,17-dodecahydrocyclopenta[a]phenanthren-16-one.
| Compound Name | (3S,10R,13S,17R)-17-[(2R)-but-3-en-2-yl]-3-[tert-butyl(dimethyl)silyl]oxy-10,13-dimethyl-1,2,3,4,7,8,9,11,12,14,15,17-dodecahydrocyclopenta[a]phenanthren-16-one |
|---|---|
| PubChem CID | 89081978 |
| Molecular Formula | C29H48O2Si |
| Molecular Weight | 456.79 g/mol |
| Exact Mass | 456.34 |
| IUPAC Name | (3S,10R,13S,17R)-17-[(2R)-but-3-en-2-yl]-3-[tert-butyl(dimethyl)silyl]oxy-10,13-dimethyl-1,2,3,4,7,8,9,11,12,14,15,17-dodecahydrocyclopenta[a]phenanthren-16-one |
| SMILES | C=C[C@@H](C)[C@H]1C(=O)CC2C3CC=C4C[C@@H](O[Si](C)(C)C(C)(C)C)CC[C@]4(C)C3CC[C@@]21C |
| InChI | InChI=1S/C29H48O2Si/c1-10-19(2)26-25(30)18-24-22-12-11-20-17-21(31-32(8,9)27(3,4)5)13-15-28(20,6)23(22)14-16-29(24,26)7/h10-11,19,21-24,26H,1,12-18H2,2-9H3/t19-,21+,22?,23?,24?,26+,28+,29+/m1/s1 |
| InChIKey | MYTWVLSHZJCJOQ-BWHBKUBNSA-N |
| XLogP | 7.96 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.79 |
| LogP ≤ 5 | 7.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|