C38H54O3Si — CID 72721969
1-[(3S,10R,13S,17S)-3-[tert-butyl(diphenyl)silyl]oxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]propane-1,3-diol (PubChem CID 72721969) has the molecular formula C38H54O3Si and a molecular weight of 586.93 g/mol. Its IUPAC name is 1-[(3S,10R,13S,17S)-3-[tert-butyl(diphenyl)silyl]oxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]propane-1,3-diol.
| Compound Name | 1-[(3S,10R,13S,17S)-3-[tert-butyl(diphenyl)silyl]oxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]propane-1,3-diol |
|---|---|
| PubChem CID | 72721969 |
| Molecular Formula | C38H54O3Si |
| Molecular Weight | 586.93 g/mol |
| Exact Mass | 586.38 |
| IUPAC Name | 1-[(3S,10R,13S,17S)-3-[tert-butyl(diphenyl)silyl]oxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]propane-1,3-diol |
| SMILES | CC(C)(C)[Si](O[C@H]1CC[C@@]2(C)C(=CCC3C2CC[C@@]2(C)C3CC[C@@H]2C(O)CCO)C1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C38H54O3Si/c1-36(2,3)42(29-12-8-6-9-13-29,30-14-10-7-11-15-30)41-28-20-23-37(4)27(26-28)16-17-31-32-18-19-34(35(40)22-25-39)38(32,5)24-21-33(31)37/h6-16,28,31-35,39-40H,17-26H2,1-5H3/t28-,31?,32?,33?,34+,35?,37-,38-/m0/s1 |
| InChIKey | QDFXACPWKLSZOM-XAMKRSTGSA-N |
| XLogP | 7.25 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.93 |
| LogP ≤ 5 | 7.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|