C28H38OSi — CID 99771961
[(2R,4aR,5S)-4a,5-dimethyl-3,4,5,6,7,8-hexahydro-2H-naphthalen-2-yl]oxy-tert-butyl-diphenylsilane (PubChem CID 99771961) has the molecular formula C28H38OSi and a molecular weight of 418.70 g/mol. Its IUPAC name is [(2R,4aR,5S)-4a,5-dimethyl-3,4,5,6,7,8-hexahydro-2H-naphthalen-2-yl]oxy-tert-butyl-diphenylsilane.
| Compound Name | [(2R,4aR,5S)-4a,5-dimethyl-3,4,5,6,7,8-hexahydro-2H-naphthalen-2-yl]oxy-tert-butyl-diphenylsilane |
|---|---|
| PubChem CID | 99771961 |
| Molecular Formula | C28H38OSi |
| Molecular Weight | 418.70 g/mol |
| Exact Mass | 418.27 |
| IUPAC Name | [(2R,4aR,5S)-4a,5-dimethyl-3,4,5,6,7,8-hexahydro-2H-naphthalen-2-yl]oxy-tert-butyl-diphenylsilane |
| SMILES | C[C@H]1CCCC2=C[C@H](O[Si](c3ccccc3)(c3ccccc3)C(C)(C)C)CC[C@@]21C |
| InChI | InChI=1S/C28H38OSi/c1-22-13-12-14-23-21-24(19-20-28(22,23)5)29-30(27(2,3)4,25-15-8-6-9-16-25)26-17-10-7-11-18-26/h6-11,15-18,21-22,24H,12-14,19-20H2,1-5H3/t22-,24+,28+/m0/s1 |
| InChIKey | RHFYZNLWSJRIBA-ZQIDGUAPSA-N |
| XLogP | 6.48 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.70 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|