C22H25IO2Si — CID 11352003
4-[tert-butyl(diphenyl)silyl]oxy-2-iodocyclohex-2-en-1-one (PubChem CID 11352003) has the molecular formula C22H25IO2Si and a molecular weight of 476.43 g/mol. Its IUPAC name is 4-[tert-butyl(diphenyl)silyl]oxy-2-iodocyclohex-2-en-1-one.
| Compound Name | 4-[tert-butyl(diphenyl)silyl]oxy-2-iodocyclohex-2-en-1-one |
|---|---|
| PubChem CID | 11352003 |
| Molecular Formula | C22H25IO2Si |
| Molecular Weight | 476.43 g/mol |
| Exact Mass | 476.07 |
| IUPAC Name | 4-[tert-butyl(diphenyl)silyl]oxy-2-iodocyclohex-2-en-1-one |
| SMILES | CC(C)(C)[Si](OC1C=C(I)C(=O)CC1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C22H25IO2Si/c1-22(2,3)26(18-10-6-4-7-11-18,19-12-8-5-9-13-19)25-17-14-15-21(24)20(23)16-17/h4-13,16-17H,14-15H2,1-3H3 |
| InChIKey | OBNZUTGQSODCGZ-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.43 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|