C22H30O2Si — CID 125472963
tert-butyl-[(3R)-2,2-dimethyloxolan-3-yl]oxy-diphenylsilane (PubChem CID 125472963) has the molecular formula C22H30O2Si and a molecular weight of 354.57 g/mol. Its IUPAC name is tert-butyl-[(3R)-2,2-dimethyloxolan-3-yl]oxy-diphenylsilane.
| Compound Name | tert-butyl-[(3R)-2,2-dimethyloxolan-3-yl]oxy-diphenylsilane |
|---|---|
| PubChem CID | 125472963 |
| Molecular Formula | C22H30O2Si |
| Molecular Weight | 354.57 g/mol |
| Exact Mass | 354.20 |
| IUPAC Name | tert-butyl-[(3R)-2,2-dimethyloxolan-3-yl]oxy-diphenylsilane |
| SMILES | CC1(C)OCC[C@H]1O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C22H30O2Si/c1-21(2,3)25(18-12-8-6-9-13-18,19-14-10-7-11-15-19)24-20-16-17-23-22(20,4)5/h6-15,20H,16-17H2,1-5H3/t20-/m1/s1 |
| InChIKey | VRVQLGZBUPKZMS-HXUWFJFHSA-N |
| XLogP | 4.13 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.57 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|