C26H36O3Si — CID 146029391
tert-butyl-[[(8S)-7,7-dimethyl-1,4-dioxaspiro[4.5]decan-8-yl]oxy]-diphenylsilane (PubChem CID 146029391) has the molecular formula C26H36O3Si and a molecular weight of 424.66 g/mol. Its IUPAC name is tert-butyl-[[(8S)-7,7-dimethyl-1,4-dioxaspiro[4.5]decan-8-yl]oxy]-diphenylsilane.
| Compound Name | tert-butyl-[[(8S)-7,7-dimethyl-1,4-dioxaspiro[4.5]decan-8-yl]oxy]-diphenylsilane |
|---|---|
| PubChem CID | 146029391 |
| Molecular Formula | C26H36O3Si |
| Molecular Weight | 424.66 g/mol |
| Exact Mass | 424.24 |
| IUPAC Name | tert-butyl-[[(8S)-7,7-dimethyl-1,4-dioxaspiro[4.5]decan-8-yl]oxy]-diphenylsilane |
| SMILES | CC1(C)CC2(CC[C@@H]1O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)OCCO2 |
| InChI | InChI=1S/C26H36O3Si/c1-24(2,3)30(21-12-8-6-9-13-21,22-14-10-7-11-15-22)29-23-16-17-26(20-25(23,4)5)27-18-19-28-26/h6-15,23H,16-20H2,1-5H3/t23-/m0/s1 |
| InChIKey | LGUKHTSWAJMKLT-QHCPKHFHSA-N |
| XLogP | 4.88 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.66 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|