C26H36INO2Si — CID 156730757
tert-butyl-[4-(4-iodopiperidin-1-yl)-4-methyloxolan-3-yl]oxy-diphenylsilane (PubChem CID 156730757) has the molecular formula C26H36INO2Si and a molecular weight of 549.57 g/mol. Its IUPAC name is tert-butyl-[4-(4-iodopiperidin-1-yl)-4-methyloxolan-3-yl]oxy-diphenylsilane.
| Compound Name | tert-butyl-[4-(4-iodopiperidin-1-yl)-4-methyloxolan-3-yl]oxy-diphenylsilane |
|---|---|
| PubChem CID | 156730757 |
| Molecular Formula | C26H36INO2Si |
| Molecular Weight | 549.57 g/mol |
| Exact Mass | 549.16 |
| IUPAC Name | tert-butyl-[4-(4-iodopiperidin-1-yl)-4-methyloxolan-3-yl]oxy-diphenylsilane |
| SMILES | CC1(N2CCC(I)CC2)COCC1O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C26H36INO2Si/c1-25(2,3)31(22-11-7-5-8-12-22,23-13-9-6-10-14-23)30-24-19-29-20-26(24,4)28-17-15-21(27)16-18-28/h5-14,21,24H,15-20H2,1-4H3 |
| InChIKey | CGHBHHIOYCSVRK-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.57 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|