C31H46N2O4Si — CID 163277617
tert-butyl (3S)-4-[(3S,4S)-4-[tert-butyl(diphenyl)silyl]oxy-3-methyloxolan-3-yl]-3-methylpiperazine-1-carboxylate (PubChem CID 163277617) has the molecular formula C31H46N2O4Si and a molecular weight of 538.81 g/mol. Its IUPAC name is tert-butyl (3S)-4-[(3S,4S)-4-[tert-butyl(diphenyl)silyl]oxy-3-methyloxolan-3-yl]-3-methylpiperazine-1-carboxylate.
| Compound Name | tert-butyl (3S)-4-[(3S,4S)-4-[tert-butyl(diphenyl)silyl]oxy-3-methyloxolan-3-yl]-3-methylpiperazine-1-carboxylate |
|---|---|
| PubChem CID | 163277617 |
| Molecular Formula | C31H46N2O4Si |
| Molecular Weight | 538.81 g/mol |
| Exact Mass | 538.32 |
| IUPAC Name | tert-butyl (3S)-4-[(3S,4S)-4-[tert-butyl(diphenyl)silyl]oxy-3-methyloxolan-3-yl]-3-methylpiperazine-1-carboxylate |
| SMILES | C[C@H]1CN(C(=O)OC(C)(C)C)CCN1[C@@]1(C)COC[C@H]1O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C31H46N2O4Si/c1-24-21-32(28(34)36-29(2,3)4)19-20-33(24)31(8)23-35-22-27(31)37-38(30(5,6)7,25-15-11-9-12-16-25)26-17-13-10-14-18-26/h9-18,24,27H,19-23H2,1-8H3/t24-,27+,31-/m0/s1 |
| InChIKey | NMTHDLQODJQTKW-FDZWRVBXSA-N |
| XLogP | 4.66 |
| TPSA | 51.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.81 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|