C28H40N2O3Si — CID 171498404
tert-butyl 8-[tert-butyl(diphenyl)silyl]oxy-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine-2-carboxylate (PubChem CID 171498404) has the molecular formula C28H40N2O3Si and a molecular weight of 480.73 g/mol. Its IUPAC name is tert-butyl 8-[tert-butyl(diphenyl)silyl]oxy-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine-2-carboxylate.
| Compound Name | tert-butyl 8-[tert-butyl(diphenyl)silyl]oxy-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine-2-carboxylate |
|---|---|
| PubChem CID | 171498404 |
| Molecular Formula | C28H40N2O3Si |
| Molecular Weight | 480.73 g/mol |
| Exact Mass | 480.28 |
| IUPAC Name | tert-butyl 8-[tert-butyl(diphenyl)silyl]oxy-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine-2-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCN2CCC(O[Si](c3ccccc3)(c3ccccc3)C(C)(C)C)C2C1 |
| InChI | InChI=1S/C28H40N2O3Si/c1-27(2,3)32-26(31)30-20-19-29-18-17-25(24(29)21-30)33-34(28(4,5)6,22-13-9-7-10-14-22)23-15-11-8-12-16-23/h7-16,24-25H,17-21H2,1-6H3 |
| InChIKey | AMGSFOLLIYJFFL-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.73 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|