C28H40N2O5Si — CID 155630213
tert-butyl (2S,3S)-3-[tert-butyl(diphenyl)silyl]oxy-2-[methoxy(methyl)carbamoyl]pyrrolidine-1-carboxylate (PubChem CID 155630213) has the molecular formula C28H40N2O5Si and a molecular weight of 512.72 g/mol. Its IUPAC name is tert-butyl (2S,3S)-3-[tert-butyl(diphenyl)silyl]oxy-2-[methoxy(methyl)carbamoyl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2S,3S)-3-[tert-butyl(diphenyl)silyl]oxy-2-[methoxy(methyl)carbamoyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 155630213 |
| Molecular Formula | C28H40N2O5Si |
| Molecular Weight | 512.72 g/mol |
| Exact Mass | 512.27 |
| IUPAC Name | tert-butyl (2S,3S)-3-[tert-butyl(diphenyl)silyl]oxy-2-[methoxy(methyl)carbamoyl]pyrrolidine-1-carboxylate |
| SMILES | CON(C)C(=O)[C@@H]1[C@@H](O[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)CCN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C28H40N2O5Si/c1-27(2,3)34-26(32)30-20-19-23(24(30)25(31)29(7)33-8)35-36(28(4,5)6,21-15-11-9-12-16-21)22-17-13-10-14-18-22/h9-18,23-24H,19-20H2,1-8H3/t23-,24-/m0/s1 |
| InChIKey | VSRIHYMFMKRMSM-ZEQRLZLVSA-N |
| XLogP | 3.96 |
| TPSA | 68.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.72 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|