C12H22N2O5 — CID 57194245
tert-butyl (2S,3S)-3-hydroxy-2-[methoxy(methyl)carbamoyl]pyrrolidine-1-carboxylate (PubChem CID 57194245) has the molecular formula C12H22N2O5 and a molecular weight of 274.32 g/mol. Its IUPAC name is tert-butyl (2S,3S)-3-hydroxy-2-[methoxy(methyl)carbamoyl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2S,3S)-3-hydroxy-2-[methoxy(methyl)carbamoyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 57194245 |
| Molecular Formula | C12H22N2O5 |
| Molecular Weight | 274.32 g/mol |
| Exact Mass | 274.15 |
| IUPAC Name | tert-butyl (2S,3S)-3-hydroxy-2-[methoxy(methyl)carbamoyl]pyrrolidine-1-carboxylate |
| SMILES | CON(C)C(=O)[C@@H]1[C@@H](O)CCN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C12H22N2O5/c1-12(2,3)19-11(17)14-7-6-8(15)9(14)10(16)13(4)18-5/h8-9,15H,6-7H2,1-5H3/t8-,9-/m0/s1 |
| InChIKey | FPAWTGZLSUBDLL-IUCAKERBSA-N |
| XLogP | 0.38 |
| TPSA | 79.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.32 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|