C12H22N2O5 — CID 22309118
tert-butyl 3-[methoxy(methyl)carbamoyl]morpholine-4-carboxylate (PubChem CID 22309118) has the molecular formula C12H22N2O5 and a molecular weight of 274.32 g/mol. Its IUPAC name is tert-butyl 3-[methoxy(methyl)carbamoyl]morpholine-4-carboxylate.
| Compound Name | tert-butyl 3-[methoxy(methyl)carbamoyl]morpholine-4-carboxylate |
|---|---|
| PubChem CID | 22309118 |
| Molecular Formula | C12H22N2O5 |
| Molecular Weight | 274.32 g/mol |
| Exact Mass | 274.15 |
| IUPAC Name | tert-butyl 3-[methoxy(methyl)carbamoyl]morpholine-4-carboxylate |
| SMILES | CON(C)C(=O)C1COCCN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C12H22N2O5/c1-12(2,3)19-11(16)14-6-7-18-8-9(14)10(15)13(4)17-5/h9H,6-8H2,1-5H3 |
| InChIKey | LIHPEZIUWNJQDZ-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 68.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.32 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|