C16H19F2NO4 — CID 103553945
tert-butyl 3-(3,5-difluorobenzoyl)morpholine-4-carboxylate (PubChem CID 103553945) has the molecular formula C16H19F2NO4 and a molecular weight of 327.33 g/mol. Its IUPAC name is tert-butyl 3-(3,5-difluorobenzoyl)morpholine-4-carboxylate.
| Compound Name | tert-butyl 3-(3,5-difluorobenzoyl)morpholine-4-carboxylate |
|---|---|
| PubChem CID | 103553945 |
| Molecular Formula | C16H19F2NO4 |
| Molecular Weight | 327.33 g/mol |
| Exact Mass | 327.13 |
| IUPAC Name | tert-butyl 3-(3,5-difluorobenzoyl)morpholine-4-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCOCC1C(=O)c1cc(F)cc(F)c1 |
| InChI | InChI=1S/C16H19F2NO4/c1-16(2,3)23-15(21)19-4-5-22-9-13(19)14(20)10-6-11(17)8-12(18)7-10/h6-8,13H,4-5,9H2,1-3H3 |
| InChIKey | XIXWXMPXEGLWES-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.33 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |