C15H23N3O4 — CID 103554047
tert-butyl 3-(2-ethylpyrazole-3-carbonyl)morpholine-4-carboxylate (PubChem CID 103554047) has the molecular formula C15H23N3O4 and a molecular weight of 309.37 g/mol. Its IUPAC name is tert-butyl 3-(2-ethylpyrazole-3-carbonyl)morpholine-4-carboxylate.
| Compound Name | tert-butyl 3-(2-ethylpyrazole-3-carbonyl)morpholine-4-carboxylate |
|---|---|
| PubChem CID | 103554047 |
| Molecular Formula | C15H23N3O4 |
| Molecular Weight | 309.37 g/mol |
| Exact Mass | 309.17 |
| IUPAC Name | tert-butyl 3-(2-ethylpyrazole-3-carbonyl)morpholine-4-carboxylate |
| SMILES | CCn1nccc1C(=O)C1COCCN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C15H23N3O4/c1-5-18-11(6-7-16-18)13(19)12-10-21-9-8-17(12)14(20)22-15(2,3)4/h6-7,12H,5,8-10H2,1-4H3 |
| InChIKey | IRZCMIHVFGCVRW-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 73.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.37 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |