C15H18F2N2O4 — CID 146014037
tert-butyl 3-(2,5-difluoropyridine-4-carbonyl)morpholine-4-carboxylate (PubChem CID 146014037) has the molecular formula C15H18F2N2O4 and a molecular weight of 328.32 g/mol. Its IUPAC name is tert-butyl 3-(2,5-difluoropyridine-4-carbonyl)morpholine-4-carboxylate.
| Compound Name | tert-butyl 3-(2,5-difluoropyridine-4-carbonyl)morpholine-4-carboxylate |
|---|---|
| PubChem CID | 146014037 |
| Molecular Formula | C15H18F2N2O4 |
| Molecular Weight | 328.32 g/mol |
| Exact Mass | 328.12 |
| IUPAC Name | tert-butyl 3-(2,5-difluoropyridine-4-carbonyl)morpholine-4-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCOCC1C(=O)c1cc(F)ncc1F |
| InChI | InChI=1S/C15H18F2N2O4/c1-15(2,3)23-14(21)19-4-5-22-8-11(19)13(20)9-6-12(17)18-7-10(9)16/h6-7,11H,4-5,8H2,1-3H3 |
| InChIKey | JYUUXGJZHAHPJF-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 68.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.32 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|