C16H23N3O5 — CID 177204743
tert-butyl (3R)-3-(5-amino-2-methoxycarbonyl-4-pyridinyl)morpholine-4-carboxylate (PubChem CID 177204743) has the molecular formula C16H23N3O5 and a molecular weight of 337.38 g/mol. Its IUPAC name is tert-butyl (3R)-3-(5-amino-2-methoxycarbonyl-4-pyridinyl)morpholine-4-carboxylate.
| Compound Name | tert-butyl (3R)-3-(5-amino-2-methoxycarbonyl-4-pyridinyl)morpholine-4-carboxylate |
|---|---|
| PubChem CID | 177204743 |
| Molecular Formula | C16H23N3O5 |
| Molecular Weight | 337.38 g/mol |
| Exact Mass | 337.16 |
| IUPAC Name | tert-butyl (3R)-3-(5-amino-2-methoxycarbonyl-4-pyridinyl)morpholine-4-carboxylate |
| SMILES | COC(=O)c1cc([C@@H]2COCCN2C(=O)OC(C)(C)C)c(N)cn1 |
| InChI | InChI=1S/C16H23N3O5/c1-16(2,3)24-15(21)19-5-6-23-9-13(19)10-7-12(14(20)22-4)18-8-11(10)17/h7-8,13H,5-6,9,17H2,1-4H3/t13-/m0/s1 |
| InChIKey | FHDBOYRPMNNJQE-ZDUSSCGKSA-N |
| XLogP | 1.76 |
| TPSA | 103.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.38 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |