C15H22N2O3 — CID 67388382
tert-butyl (3R)-3-(4-aminophenyl)morpholine-4-carboxylate (PubChem CID 67388382) has the molecular formula C15H22N2O3 and a molecular weight of 278.35 g/mol. Its IUPAC name is tert-butyl (3R)-3-(4-aminophenyl)morpholine-4-carboxylate.
| Compound Name | tert-butyl (3R)-3-(4-aminophenyl)morpholine-4-carboxylate |
|---|---|
| PubChem CID | 67388382 |
| Molecular Formula | C15H22N2O3 |
| Molecular Weight | 278.35 g/mol |
| Exact Mass | 278.16 |
| IUPAC Name | tert-butyl (3R)-3-(4-aminophenyl)morpholine-4-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCOC[C@H]1c1ccc(N)cc1 |
| InChI | InChI=1S/C15H22N2O3/c1-15(2,3)20-14(18)17-8-9-19-10-13(17)11-4-6-12(16)7-5-11/h4-7,13H,8-10,16H2,1-3H3/t13-/m0/s1 |
| InChIKey | GFKWUTNMYMLPIK-ZDUSSCGKSA-N |
| XLogP | 2.58 |
| TPSA | 64.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.35 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|