C46H68N6O7 — CID 160578774
tert-butyl 2-(4-aminophenyl)morpholine-4-carboxylate;tert-butyl 2-(4-aminophenyl)piperidine-1-carboxylate;tert-butyl 2-(4-aminophenyl)pyrrolidine-1-carboxylate (PubChem CID 160578774) has the molecular formula C46H68N6O7 and a molecular weight of 817.08 g/mol. Its IUPAC name is tert-butyl 2-(4-aminophenyl)morpholine-4-carboxylate;tert-butyl 2-(4-aminophenyl)piperidine-1-carboxylate;tert-butyl 2-(4-aminophenyl)pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 2-(4-aminophenyl)morpholine-4-carboxylate;tert-butyl 2-(4-aminophenyl)piperidine-1-carboxylate;tert-butyl 2-(4-aminophenyl)pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 160578774 |
| Molecular Formula | C46H68N6O7 |
| Molecular Weight | 817.08 g/mol |
| Exact Mass | 816.51 |
| IUPAC Name | tert-butyl 2-(4-aminophenyl)morpholine-4-carboxylate;tert-butyl 2-(4-aminophenyl)piperidine-1-carboxylate;tert-butyl 2-(4-aminophenyl)pyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCCC1c1ccc(N)cc1.CC(C)(C)OC(=O)N1CCCCC1c1ccc(N)cc1.CC(C)(C)OC(=O)N1CCOC(c2ccc(N)cc2)C1 |
| InChI | InChI=1S/C16H24N2O2.C15H22N2O3.C15H22N2O2/c1-16(2,3)20-15(19)18-11-5-4-6-14(18)12-7-9-13(17)10-8-12;1-15(2,3)20-14(18)17-8-9-19-13(10-17)11-4-6-12(16)7-5-11;1-15(2,3)19-14(18)17-10-4-5-13(17)11-6-8-12(16)9-7-11/h7-10,14H,4-6,11,17H2,1-3H3;4-7,13H,8-10,16H2,1-3H3;6-9,13H,4-5,10,16H2,1-3H3 |
| InChIKey | RBMPCZWWONVGSO-UHFFFAOYSA-N |
| XLogP | 9.65 |
| TPSA | 175.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 817.08 |
| LogP ≤ 5 | 9.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|