C14H21N2O4+ — CID 176950779
tert-butyl 2-(1-hydroxypyridin-1-ium-4-yl)morpholine-4-carboxylate (PubChem CID 176950779) has the molecular formula C14H21N2O4+ and a molecular weight of 281.33 g/mol. Its IUPAC name is tert-butyl 2-(1-hydroxypyridin-1-ium-4-yl)morpholine-4-carboxylate.
| Compound Name | tert-butyl 2-(1-hydroxypyridin-1-ium-4-yl)morpholine-4-carboxylate |
|---|---|
| PubChem CID | 176950779 |
| Molecular Formula | C14H21N2O4+ |
| Molecular Weight | 281.33 g/mol |
| Exact Mass | 281.15 |
| IUPAC Name | tert-butyl 2-(1-hydroxypyridin-1-ium-4-yl)morpholine-4-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCOC(c2cc[n+](O)cc2)C1 |
| InChI | InChI=1S/C14H21N2O4/c1-14(2,3)20-13(17)15-8-9-19-12(10-15)11-4-6-16(18)7-5-11/h4-7,12,18H,8-10H2,1-3H3/q+1 |
| InChIKey | LBXVPZLAVWYUDZ-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 62.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.33 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|