C16H22N2O4 — CID 123673146
tert-butyl (2R)-2-[4-(nitrosomethyl)phenyl]morpholine-4-carboxylate (PubChem CID 123673146) has the molecular formula C16H22N2O4 and a molecular weight of 306.36 g/mol. Its IUPAC name is tert-butyl (2R)-2-[4-(nitrosomethyl)phenyl]morpholine-4-carboxylate.
| Compound Name | tert-butyl (2R)-2-[4-(nitrosomethyl)phenyl]morpholine-4-carboxylate |
|---|---|
| PubChem CID | 123673146 |
| Molecular Formula | C16H22N2O4 |
| Molecular Weight | 306.36 g/mol |
| Exact Mass | 306.16 |
| IUPAC Name | tert-butyl (2R)-2-[4-(nitrosomethyl)phenyl]morpholine-4-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCO[C@H](c2ccc(CN=O)cc2)C1 |
| InChI | InChI=1S/C16H22N2O4/c1-16(2,3)22-15(19)18-8-9-21-14(11-18)13-6-4-12(5-7-13)10-17-20/h4-7,14H,8-11H2,1-3H3/t14-/m0/s1 |
| InChIKey | DDCRMSOPUOIFBS-AWEZNQCLSA-N |
| XLogP | 3.26 |
| TPSA | 68.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.36 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |