C19H24N2O5 — CID 123778325
tert-butyl 2-[4-(2-cyanoacetyl)-3-methoxyphenyl]morpholine-4-carboxylate (PubChem CID 123778325) has the molecular formula C19H24N2O5 and a molecular weight of 360.41 g/mol. Its IUPAC name is tert-butyl 2-[4-(2-cyanoacetyl)-3-methoxyphenyl]morpholine-4-carboxylate.
| Compound Name | tert-butyl 2-[4-(2-cyanoacetyl)-3-methoxyphenyl]morpholine-4-carboxylate |
|---|---|
| PubChem CID | 123778325 |
| Molecular Formula | C19H24N2O5 |
| Molecular Weight | 360.41 g/mol |
| Exact Mass | 360.17 |
| IUPAC Name | tert-butyl 2-[4-(2-cyanoacetyl)-3-methoxyphenyl]morpholine-4-carboxylate |
| SMILES | COc1cc(C2CN(C(=O)OC(C)(C)C)CCO2)ccc1C(=O)CC#N |
| InChI | InChI=1S/C19H24N2O5/c1-19(2,3)26-18(23)21-9-10-25-17(12-21)13-5-6-14(15(22)7-8-20)16(11-13)24-4/h5-6,11,17H,7,9-10,12H2,1-4H3 |
| InChIKey | XNVWYSLWHXQFQG-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 88.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.41 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |