C20H25FN2O4 — CID 118294812
tert-butyl 4-[4-(2-cyanoacetyl)-3-methoxyphenyl]-4-fluoropiperidine-1-carboxylate (PubChem CID 118294812) has the molecular formula C20H25FN2O4 and a molecular weight of 376.43 g/mol. Its IUPAC name is tert-butyl 4-[4-(2-cyanoacetyl)-3-methoxyphenyl]-4-fluoropiperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[4-(2-cyanoacetyl)-3-methoxyphenyl]-4-fluoropiperidine-1-carboxylate |
|---|---|
| PubChem CID | 118294812 |
| Molecular Formula | C20H25FN2O4 |
| Molecular Weight | 376.43 g/mol |
| Exact Mass | 376.18 |
| IUPAC Name | tert-butyl 4-[4-(2-cyanoacetyl)-3-methoxyphenyl]-4-fluoropiperidine-1-carboxylate |
| SMILES | COc1cc(C2(F)CCN(C(=O)OC(C)(C)C)CC2)ccc1C(=O)CC#N |
| InChI | InChI=1S/C20H25FN2O4/c1-19(2,3)27-18(25)23-11-8-20(21,9-12-23)14-5-6-15(16(24)7-10-22)17(13-14)26-4/h5-6,13H,7-9,11-12H2,1-4H3 |
| InChIKey | IEPXQRNCWLDZQJ-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 79.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.43 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |