C20H30N2O3 — CID 144802299
tert-butyl 4-cyano-4-[4-(hydroxymethyl)phenyl]piperidine-1-carboxylate;ethane (PubChem CID 144802299) has the molecular formula C20H30N2O3 and a molecular weight of 346.47 g/mol. Its IUPAC name is tert-butyl 4-cyano-4-[4-(hydroxymethyl)phenyl]piperidine-1-carboxylate;ethane.
| Compound Name | tert-butyl 4-cyano-4-[4-(hydroxymethyl)phenyl]piperidine-1-carboxylate;ethane |
|---|---|
| PubChem CID | 144802299 |
| Molecular Formula | C20H30N2O3 |
| Molecular Weight | 346.47 g/mol |
| Exact Mass | 346.23 |
| IUPAC Name | tert-butyl 4-cyano-4-[4-(hydroxymethyl)phenyl]piperidine-1-carboxylate;ethane |
| SMILES | CC.CC(C)(C)OC(=O)N1CCC(C#N)(c2ccc(CO)cc2)CC1 |
| InChI | InChI=1S/C18H24N2O3.C2H6/c1-17(2,3)23-16(22)20-10-8-18(13-19,9-11-20)15-6-4-14(12-21)5-7-15;1-2/h4-7,21H,8-12H2,1-3H3;1-2H3 |
| InChIKey | NMIBOGIWWRYCAC-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 73.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.47 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |