C16H21N3O2 — CID 53439111
tert-butyl 4-cyano-4-pyridin-2-ylpiperidine-1-carboxylate (PubChem CID 53439111) has the molecular formula C16H21N3O2 and a molecular weight of 287.36 g/mol. Its IUPAC name is tert-butyl 4-cyano-4-pyridin-2-ylpiperidine-1-carboxylate.
| Compound Name | tert-butyl 4-cyano-4-pyridin-2-ylpiperidine-1-carboxylate |
|---|---|
| PubChem CID | 53439111 |
| Molecular Formula | C16H21N3O2 |
| Molecular Weight | 287.36 g/mol |
| Exact Mass | 287.16 |
| IUPAC Name | tert-butyl 4-cyano-4-pyridin-2-ylpiperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(C#N)(c2ccccn2)CC1 |
| InChI | InChI=1S/C16H21N3O2/c1-15(2,3)21-14(20)19-10-7-16(12-17,8-11-19)13-6-4-5-9-18-13/h4-6,9H,7-8,10-11H2,1-3H3 |
| InChIKey | OUILGYJQVAMETA-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 66.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.36 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |