C14H20FN3O2 — CID 69455005
tert-butyl 4-fluoro-4-pyrimidin-2-ylpiperidine-1-carboxylate (PubChem CID 69455005) has the molecular formula C14H20FN3O2 and a molecular weight of 281.33 g/mol. Its IUPAC name is tert-butyl 4-fluoro-4-pyrimidin-2-ylpiperidine-1-carboxylate.
| Compound Name | tert-butyl 4-fluoro-4-pyrimidin-2-ylpiperidine-1-carboxylate |
|---|---|
| PubChem CID | 69455005 |
| Molecular Formula | C14H20FN3O2 |
| Molecular Weight | 281.33 g/mol |
| Exact Mass | 281.15 |
| IUPAC Name | tert-butyl 4-fluoro-4-pyrimidin-2-ylpiperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(F)(c2ncccn2)CC1 |
| InChI | InChI=1S/C14H20FN3O2/c1-13(2,3)20-12(19)18-9-5-14(15,6-10-18)11-16-7-4-8-17-11/h4,7-8H,5-6,9-10H2,1-3H3 |
| InChIKey | HYZNWRLUEJYJLB-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 55.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.33 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |