C15H19N3O2 — CID 22236898
tert-butyl 3-cyano-3-pyridin-4-ylpyrrolidine-1-carboxylate (PubChem CID 22236898) has the molecular formula C15H19N3O2 and a molecular weight of 273.34 g/mol. Its IUPAC name is tert-butyl 3-cyano-3-pyridin-4-ylpyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 3-cyano-3-pyridin-4-ylpyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 22236898 |
| Molecular Formula | C15H19N3O2 |
| Molecular Weight | 273.34 g/mol |
| Exact Mass | 273.15 |
| IUPAC Name | tert-butyl 3-cyano-3-pyridin-4-ylpyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(C#N)(c2ccncc2)C1 |
| InChI | InChI=1S/C15H19N3O2/c1-14(2,3)20-13(19)18-9-6-15(10-16,11-18)12-4-7-17-8-5-12/h4-5,7-8H,6,9,11H2,1-3H3 |
| InChIKey | AWGIVTSINRPYCM-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 66.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.34 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |