C13H24N2O3Si — CID 124637594
tert-butyl (3S)-3-cyano-3-trimethylsilyloxypyrrolidine-1-carboxylate (PubChem CID 124637594) has the molecular formula C13H24N2O3Si and a molecular weight of 284.43 g/mol. Its IUPAC name is tert-butyl (3S)-3-cyano-3-trimethylsilyloxypyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (3S)-3-cyano-3-trimethylsilyloxypyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 124637594 |
| Molecular Formula | C13H24N2O3Si |
| Molecular Weight | 284.43 g/mol |
| Exact Mass | 284.16 |
| IUPAC Name | tert-butyl (3S)-3-cyano-3-trimethylsilyloxypyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC[C@](C#N)(O[Si](C)(C)C)C1 |
| InChI | InChI=1S/C13H24N2O3Si/c1-12(2,3)17-11(16)15-8-7-13(9-14,10-15)18-19(4,5)6/h7-8,10H2,1-6H3/t13-/m1/s1 |
| InChIKey | PVWFGQURJWJHJF-CYBMUJFWSA-N |
| XLogP | 2.74 |
| TPSA | 62.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.43 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|